C49H49N — CID 166564237
4-tert-butyl-3-(3,6-ditert-butyl-9H-fluoren-9-yl)-5-(2,3,4,5,6-pentadeuteriophenyl)-9-phenylcarbazole (PubChem CID 166564237) has the molecular formula C49H49N and a molecular weight of 656.97 g/mol. Its IUPAC name is 4-tert-butyl-3-(3,6-ditert-butyl-9H-fluoren-9-yl)-5-(2,3,4,5,6-pentadeuteriophenyl)-9-phenylcarbazole.
| Compound Name | 4-tert-butyl-3-(3,6-ditert-butyl-9H-fluoren-9-yl)-5-(2,3,4,5,6-pentadeuteriophenyl)-9-phenylcarbazole |
|---|---|
| PubChem CID | 166564237 |
| Molecular Formula | C49H49N |
| Molecular Weight | 656.97 g/mol |
| Exact Mass | 656.42 |
| IUPAC Name | 4-tert-butyl-3-(3,6-ditert-butyl-9H-fluoren-9-yl)-5-(2,3,4,5,6-pentadeuteriophenyl)-9-phenylcarbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3c2c2c(C(C)(C)C)c(C4c5ccc(C(C)(C)C)cc5-c5cc(C(C)(C)C)ccc54)ccc2n3-c2ccccc2)c([2H])c1[2H] |
| InChI | InChI=1S/C49H49N/c1-47(2,3)32-23-25-36-39(29-32)40-30-33(48(4,5)6)24-26-37(40)43(36)38-27-28-42-45(46(38)49(7,8)9)44-35(31-17-12-10-13-18-31)21-16-22-41(44)50(42)34-19-14-11-15-20-34/h10-30,43H,1-9H3/i10D,12D,13D,17D,18D |
| InChIKey | LEFQBAZLRMDITG-PULSLKEDSA-N |
| XLogP | 13.50 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.97 |
| LogP ≤ 5 | 13.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |