C31H23N — CID 164845414
4-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)-3,9-diphenylcarbazole (PubChem CID 164845414) has the molecular formula C31H23N and a molecular weight of 414.56 g/mol. Its IUPAC name is 4-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)-3,9-diphenylcarbazole.
| Compound Name | 4-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)-3,9-diphenylcarbazole |
|---|---|
| PubChem CID | 164845414 |
| Molecular Formula | C31H23N |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 4-methyl-5-(2,3,4,5,6-pentadeuteriophenyl)-3,9-diphenylcarbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3c2c2c(C)c(-c4ccccc4)ccc2n3-c2ccccc2)c([2H])c1[2H] |
| InChI | InChI=1S/C31H23N/c1-22-26(23-12-5-2-6-13-23)20-21-29-30(22)31-27(24-14-7-3-8-15-24)18-11-19-28(31)32(29)25-16-9-4-10-17-25/h2-21H,1H3/i3D,7D,8D,14D,15D |
| InChIKey | FECCHSRXYULJHY-TYEFCWAHSA-N |
| XLogP | 8.43 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |