C30H30N2O8 — CID 159485813
ethyl 2-hydroxyacetate;ethyl 2-(naphthalen-1-ylcarbamoyloxy)acetate;1-isocyanatonaphthalene (PubChem CID 159485813) has the molecular formula C30H30N2O8 and a molecular weight of 546.58 g/mol. Its IUPAC name is ethyl 2-hydroxyacetate;ethyl 2-(naphthalen-1-ylcarbamoyloxy)acetate;1-isocyanatonaphthalene.
| Compound Name | ethyl 2-hydroxyacetate;ethyl 2-(naphthalen-1-ylcarbamoyloxy)acetate;1-isocyanatonaphthalene |
|---|---|
| PubChem CID | 159485813 |
| Molecular Formula | C30H30N2O8 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | ethyl 2-hydroxyacetate;ethyl 2-(naphthalen-1-ylcarbamoyloxy)acetate;1-isocyanatonaphthalene |
| SMILES | CCOC(=O)CO.CCOC(=O)COC(=O)Nc1cccc2ccccc12.O=C=Nc1cccc2ccccc12 |
| InChI | InChI=1S/C15H15NO4.C11H7NO.C4H8O3/c1-2-19-14(17)10-20-15(18)16-13-9-5-7-11-6-3-4-8-12(11)13;13-8-12-11-7-3-5-9-4-1-2-6-10(9)11;1-2-7-4(6)3-5/h3-9H,2,10H2,1H3,(H,16,18);1-7H;5H,2-3H2,1H3 |
| InChIKey | LXOHHELTLXNLEP-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|