C26H34N2O8 — CID 158843875
ethyl 2-[(2,5-dimethylphenyl)carbamoyloxy]acetate;ethyl 2-hydroxyacetate;2-isocyanato-1,4-dimethylbenzene (PubChem CID 158843875) has the molecular formula C26H34N2O8 and a molecular weight of 502.56 g/mol. Its IUPAC name is ethyl 2-[(2,5-dimethylphenyl)carbamoyloxy]acetate;ethyl 2-hydroxyacetate;2-isocyanato-1,4-dimethylbenzene.
| Compound Name | ethyl 2-[(2,5-dimethylphenyl)carbamoyloxy]acetate;ethyl 2-hydroxyacetate;2-isocyanato-1,4-dimethylbenzene |
|---|---|
| PubChem CID | 158843875 |
| Molecular Formula | C26H34N2O8 |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | ethyl 2-[(2,5-dimethylphenyl)carbamoyloxy]acetate;ethyl 2-hydroxyacetate;2-isocyanato-1,4-dimethylbenzene |
| SMILES | CCOC(=O)CO.CCOC(=O)COC(=O)Nc1cc(C)ccc1C.Cc1ccc(C)c(N=C=O)c1 |
| InChI | InChI=1S/C13H17NO4.C9H9NO.C4H8O3/c1-4-17-12(15)8-18-13(16)14-11-7-9(2)5-6-10(11)3;1-7-3-4-8(2)9(5-7)10-6-11;1-2-7-4(6)3-5/h5-7H,4,8H2,1-3H3,(H,14,16);3-5H,1-2H3;5H,2-3H2,1H3 |
| InChIKey | IYOWBQKHTKBWKB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 140.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|