C15H26N3O3+ — CID 90714652
2-aminoethanol;[3-(2,5-dimethylanilino)-1-ethoxy-3-oxopropylidene]azanium (PubChem CID 90714652) has the molecular formula C15H26N3O3+ and a molecular weight of 296.39 g/mol. Its IUPAC name is 2-aminoethanol;[3-(2,5-dimethylanilino)-1-ethoxy-3-oxopropylidene]azanium.
| Compound Name | 2-aminoethanol;[3-(2,5-dimethylanilino)-1-ethoxy-3-oxopropylidene]azanium |
|---|---|
| PubChem CID | 90714652 |
| Molecular Formula | C15H26N3O3+ |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 2-aminoethanol;[3-(2,5-dimethylanilino)-1-ethoxy-3-oxopropylidene]azanium |
| SMILES | CCOC(=[NH2+])CC(=O)Nc1cc(C)ccc1C.NCCO |
| InChI | InChI=1S/C13H18N2O2.C2H7NO/c1-4-17-12(14)8-13(16)15-11-7-9(2)5-6-10(11)3;3-1-2-4/h5-7,14H,4,8H2,1-3H3,(H,15,16);4H,1-3H2/p+1 |
| InChIKey | LVTUJVSZHOWAHK-UHFFFAOYSA-O |
| XLogP | -0.24 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|