C6H12N6O4S — CID 159489796
bis(1H-imidazol-5-amine);sulfuric acid (PubChem CID 159489796) has the molecular formula C6H12N6O4S and a molecular weight of 264.27 g/mol. Its IUPAC name is bis(1H-imidazol-5-amine);sulfuric acid.
| Compound Name | bis(1H-imidazol-5-amine);sulfuric acid |
|---|---|
| PubChem CID | 159489796 |
| Molecular Formula | C6H12N6O4S |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | bis(1H-imidazol-5-amine);sulfuric acid |
| SMILES | Nc1cnc[nH]1.Nc1cnc[nH]1.O=S(=O)(O)O |
| InChI | InChI=1S/2C3H5N3.H2O4S/c2*4-3-1-5-2-6-3;1-5(2,3)4/h2*1-2H,4H2,(H,5,6);(H2,1,2,3,4) |
| InChIKey | HTDICIQKTHKBID-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 184.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|