C11H11N3O4S — CID 87182705
(4-carbamoylphenyl)-(1H-imidazol-5-yl)methanesulfonic acid (PubChem CID 87182705) has the molecular formula C11H11N3O4S and a molecular weight of 281.29 g/mol. Its IUPAC name is (4-carbamoylphenyl)-(1H-imidazol-5-yl)methanesulfonic acid.
| Compound Name | (4-carbamoylphenyl)-(1H-imidazol-5-yl)methanesulfonic acid |
|---|---|
| PubChem CID | 87182705 |
| Molecular Formula | C11H11N3O4S |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | (4-carbamoylphenyl)-(1H-imidazol-5-yl)methanesulfonic acid |
| SMILES | NC(=O)c1ccc(C(c2cnc[nH]2)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C11H11N3O4S/c12-11(15)8-3-1-7(2-4-8)10(19(16,17)18)9-5-13-6-14-9/h1-6,10H,(H2,12,15)(H,13,14)(H,16,17,18) |
| InChIKey | LDQWPRHKIRJCBT-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 126.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|