C7H15N5O4S — CID 174589789
guanidine;3-(1H-imidazol-5-yl)propyl hydrogen sulfate (PubChem CID 174589789) has the molecular formula C7H15N5O4S and a molecular weight of 265.29 g/mol. Its IUPAC name is guanidine;3-(1H-imidazol-5-yl)propyl hydrogen sulfate.
| Compound Name | guanidine;3-(1H-imidazol-5-yl)propyl hydrogen sulfate |
|---|---|
| PubChem CID | 174589789 |
| Molecular Formula | C7H15N5O4S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | guanidine;3-(1H-imidazol-5-yl)propyl hydrogen sulfate |
| SMILES | O=S(=O)(O)OCCCc1cnc[nH]1.[H]N=C(N)N |
| InChI | InChI=1S/C6H10N2O4S.CH5N3/c9-13(10,11)12-3-1-2-6-4-7-5-8-6;2-1(3)4/h4-5H,1-3H2,(H,7,8)(H,9,10,11);(H5,2,3,4) |
| InChIKey | BONROVCUFPGCQT-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 168.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|