C8H15IO5 — CID 15949341
(3R,4R,5R,6R)-2-ethoxy-6-(hydroxymethyl)-5-(123I)iodooxane-3,4-diol (PubChem CID 15949341) has the molecular formula C8H15IO5 and a molecular weight of 314.11 g/mol. Its IUPAC name is (3R,4R,5R,6R)-2-ethoxy-6-(hydroxymethyl)-5-(123I)iodooxane-3,4-diol.
| Compound Name | (3R,4R,5R,6R)-2-ethoxy-6-(hydroxymethyl)-5-(123I)iodooxane-3,4-diol |
|---|---|
| PubChem CID | 15949341 |
| Molecular Formula | C8H15IO5 |
| Molecular Weight | 314.11 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | (3R,4R,5R,6R)-2-ethoxy-6-(hydroxymethyl)-5-(123I)iodooxane-3,4-diol |
| SMILES | CCOC1O[C@H](CO)[C@H]([123I])[C@H](O)[C@H]1O |
| InChI | InChI=1S/C8H15IO5/c1-2-13-8-7(12)6(11)5(9)4(3-10)14-8/h4-8,10-12H,2-3H2,1H3/t4-,5+,6+,7-,8?/m1/s1/i9-4 |
| InChIKey | VDHXAYLAUAOYFU-KEIAKMIISA-N |
| XLogP | -0.73 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.11 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|