C30H26N4O3S — CID 15949963
(2S)-1-[2-(1-methylbenzimidazol-2-yl)sulfanylacetyl]-N-(3-oxo-2-phenylinden-1-yl)pyrrolidine-2-carboxamide (PubChem CID 15949963) has the molecular formula C30H26N4O3S and a molecular weight of 522.63 g/mol. Its IUPAC name is (2S)-1-[2-(1-methylbenzimidazol-2-yl)sulfanylacetyl]-N-(3-oxo-2-phenylinden-1-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[2-(1-methylbenzimidazol-2-yl)sulfanylacetyl]-N-(3-oxo-2-phenylinden-1-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 15949963 |
| Molecular Formula | C30H26N4O3S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | (2S)-1-[2-(1-methylbenzimidazol-2-yl)sulfanylacetyl]-N-(3-oxo-2-phenylinden-1-yl)pyrrolidine-2-carboxamide |
| SMILES | Cn1c(SCC(=O)N2CCC[C@H]2C(=O)NC2=C(c3ccccc3)C(=O)c3ccccc32)nc2ccccc21 |
| InChI | InChI=1S/C30H26N4O3S/c1-33-23-15-8-7-14-22(23)31-30(33)38-18-25(35)34-17-9-16-24(34)29(37)32-27-20-12-5-6-13-21(20)28(36)26(27)19-10-3-2-4-11-19/h2-8,10-15,24H,9,16-18H2,1H3,(H,32,37)/t24-/m0/s1 |
| InChIKey | PDQQICKTIHLZHO-DEOSSOPVSA-N |
| XLogP | 4.54 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|