C22H27NO5 — CID 159501939
7-hydroxy-2-methyl-4-oxo-3-(3-oxo-6-piperidin-1-ylhexyl)chromene-8-carbaldehyde (PubChem CID 159501939) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is 7-hydroxy-2-methyl-4-oxo-3-(3-oxo-6-piperidin-1-ylhexyl)chromene-8-carbaldehyde.
| Compound Name | 7-hydroxy-2-methyl-4-oxo-3-(3-oxo-6-piperidin-1-ylhexyl)chromene-8-carbaldehyde |
|---|---|
| PubChem CID | 159501939 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 7-hydroxy-2-methyl-4-oxo-3-(3-oxo-6-piperidin-1-ylhexyl)chromene-8-carbaldehyde |
| SMILES | Cc1oc2c(C=O)c(O)ccc2c(=O)c1CCC(=O)CCCN1CCCCC1 |
| InChI | InChI=1S/C22H27NO5/c1-15-17(8-7-16(25)6-5-13-23-11-3-2-4-12-23)21(27)18-9-10-20(26)19(14-24)22(18)28-15/h9-10,14,26H,2-8,11-13H2,1H3 |
| InChIKey | FJKOSCDNJKAMOM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|