C42H58N6O13 — CID 159502192
(4R)-4-amino-5-[3-[3-[2-[(5S)-5,9-bis[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-4-oxononoxy]ethoxy]propanoylamino]-4-hydroxyphenyl]-2-methylpentanoic acid (PubChem CID 159502192) has the molecular formula C42H58N6O13 and a molecular weight of 854.95 g/mol. Its IUPAC name is (4R)-4-amino-5-[3-[3-[2-[(5S)-5,9-bis[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-4-oxononoxy]ethoxy]propanoylamino]-4-hydroxyphenyl]-2-methylpentanoic acid.
| Compound Name | (4R)-4-amino-5-[3-[3-[2-[(5S)-5,9-bis[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-4-oxononoxy]ethoxy]propanoylamino]-4-hydroxyphenyl]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 159502192 |
| Molecular Formula | C42H58N6O13 |
| Molecular Weight | 854.95 g/mol |
| Exact Mass | 854.41 |
| IUPAC Name | (4R)-4-amino-5-[3-[3-[2-[(5S)-5,9-bis[4-(2,5-dioxopyrrol-1-yl)butanoylamino]-4-oxononoxy]ethoxy]propanoylamino]-4-hydroxyphenyl]-2-methylpentanoic acid |
| SMILES | CC(C[C@@H](N)Cc1ccc(O)c(NC(=O)CCOCCOCCCC(=O)[C@H](CCCCNC(=O)CCCN2C(=O)C=CC2=O)NC(=O)CCCN2C(=O)C=CC2=O)c1)C(=O)O |
| InChI | InChI=1S/C42H58N6O13/c1-28(42(58)59)25-30(43)26-29-11-12-34(50)32(27-29)46-37(53)17-22-61-24-23-60-21-6-8-33(49)31(45-36(52)10-5-20-48-40(56)15-16-41(48)57)7-2-3-18-44-35(51)9-4-19-47-38(54)13-14-39(47)55/h11-16,27-28,30-31,50H,2-10,17-26,43H2,1H3,(H,44,51)(H,45,52)(H,46,53)(H,58,59)/t28?,30-,31+/m1/s1 |
| InChIKey | LZNKJFLEXDKXHR-DKPRNJSOSA-N |
| XLogP | 1.27 |
| TPSA | 281.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.95 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|