C38H44F3N3O6S2 — CID 159510792
methyl N-[(2S,5S)-5-[5-[1-[3,3-dimethylbutyl-[(6-methyl-3-pyridinyl)sulfonyl]amino]-2-hydroxyethyl]thiophen-2-yl]-6,6,6-trifluoro-3-oxo-1,1-diphenylhexan-2-yl]carbamate (PubChem CID 159510792) has the molecular formula C38H44F3N3O6S2 and a molecular weight of 759.91 g/mol. Its IUPAC name is methyl N-[(2S,5S)-5-[5-[1-[3,3-dimethylbutyl-[(6-methyl-3-pyridinyl)sulfonyl]amino]-2-hydroxyethyl]thiophen-2-yl]-6,6,6-trifluoro-3-oxo-1,1-diphenylhexan-2-yl]carbamate.
| Compound Name | methyl N-[(2S,5S)-5-[5-[1-[3,3-dimethylbutyl-[(6-methyl-3-pyridinyl)sulfonyl]amino]-2-hydroxyethyl]thiophen-2-yl]-6,6,6-trifluoro-3-oxo-1,1-diphenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 159510792 |
| Molecular Formula | C38H44F3N3O6S2 |
| Molecular Weight | 759.91 g/mol |
| Exact Mass | 759.26 |
| IUPAC Name | methyl N-[(2S,5S)-5-[5-[1-[3,3-dimethylbutyl-[(6-methyl-3-pyridinyl)sulfonyl]amino]-2-hydroxyethyl]thiophen-2-yl]-6,6,6-trifluoro-3-oxo-1,1-diphenylhexan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)C[C@H](c1ccc(C(CO)N(CCC(C)(C)C)S(=O)(=O)c2ccc(C)nc2)s1)C(F)(F)F)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C38H44F3N3O6S2/c1-25-16-17-28(23-42-25)52(48,49)44(21-20-37(2,3)4)30(24-45)33-19-18-32(51-33)29(38(39,40)41)22-31(46)35(43-36(47)50-5)34(26-12-8-6-9-13-26)27-14-10-7-11-15-27/h6-19,23,29-30,34-35,45H,20-22,24H2,1-5H3,(H,43,47)/t29-,30?,35-/m1/s1 |
| InChIKey | MAOPXGVQTVAMMU-WEPWWJGTSA-N |
| XLogP | 7.77 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.91 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |