C33H36F3N3O6S3 — CID 158934034
methyl N-[(2S,5S)-5-[5-[(1R)-1-[(5-aminothiophen-2-yl)sulfonyl-propan-2-ylamino]-2-hydroxyethyl]thiophen-2-yl]-6,6,6-trifluoro-3-oxo-1,1-diphenylhexan-2-yl]carbamate (PubChem CID 158934034) has the molecular formula C33H36F3N3O6S3 and a molecular weight of 723.86 g/mol. Its IUPAC name is methyl N-[(2S,5S)-5-[5-[(1R)-1-[(5-aminothiophen-2-yl)sulfonyl-propan-2-ylamino]-2-hydroxyethyl]thiophen-2-yl]-6,6,6-trifluoro-3-oxo-1,1-diphenylhexan-2-yl]carbamate.
| Compound Name | methyl N-[(2S,5S)-5-[5-[(1R)-1-[(5-aminothiophen-2-yl)sulfonyl-propan-2-ylamino]-2-hydroxyethyl]thiophen-2-yl]-6,6,6-trifluoro-3-oxo-1,1-diphenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 158934034 |
| Molecular Formula | C33H36F3N3O6S3 |
| Molecular Weight | 723.86 g/mol |
| Exact Mass | 723.17 |
| IUPAC Name | methyl N-[(2S,5S)-5-[5-[(1R)-1-[(5-aminothiophen-2-yl)sulfonyl-propan-2-ylamino]-2-hydroxyethyl]thiophen-2-yl]-6,6,6-trifluoro-3-oxo-1,1-diphenylhexan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)C[C@H](c1ccc([C@@H](CO)N(C(C)C)S(=O)(=O)c2ccc(N)s2)s1)C(F)(F)F)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H36F3N3O6S3/c1-20(2)39(48(43,44)29-17-16-28(37)47-29)24(19-40)27-15-14-26(46-27)23(33(34,35)36)18-25(41)31(38-32(42)45-3)30(21-10-6-4-7-11-21)22-12-8-5-9-13-22/h4-17,20,23-24,30-31,40H,18-19,37H2,1-3H3,(H,38,42)/t23-,24-,31-/m1/s1 |
| InChIKey | JJKULYWBHBQYOB-OVMXQCPESA-N |
| XLogP | 6.69 |
| TPSA | 139.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.86 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |