C40H44F3N3O6S2 — CID 162075081
methyl N-[(2S,5S)-5-[5-[(1R)-1-[3,3-dimethylbutyl(1H-indol-6-ylsulfonyl)amino]-2-hydroxyethyl]thiophen-2-yl]-6,6,6-trifluoro-3-oxo-1,1-diphenylhexan-2-yl]carbamate (PubChem CID 162075081) has the molecular formula C40H44F3N3O6S2 and a molecular weight of 783.94 g/mol. Its IUPAC name is methyl N-[(2S,5S)-5-[5-[(1R)-1-[3,3-dimethylbutyl(1H-indol-6-ylsulfonyl)amino]-2-hydroxyethyl]thiophen-2-yl]-6,6,6-trifluoro-3-oxo-1,1-diphenylhexan-2-yl]carbamate.
| Compound Name | methyl N-[(2S,5S)-5-[5-[(1R)-1-[3,3-dimethylbutyl(1H-indol-6-ylsulfonyl)amino]-2-hydroxyethyl]thiophen-2-yl]-6,6,6-trifluoro-3-oxo-1,1-diphenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 162075081 |
| Molecular Formula | C40H44F3N3O6S2 |
| Molecular Weight | 783.94 g/mol |
| Exact Mass | 783.26 |
| IUPAC Name | methyl N-[(2S,5S)-5-[5-[(1R)-1-[3,3-dimethylbutyl(1H-indol-6-ylsulfonyl)amino]-2-hydroxyethyl]thiophen-2-yl]-6,6,6-trifluoro-3-oxo-1,1-diphenylhexan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)C[C@H](c1ccc([C@@H](CO)N(CCC(C)(C)C)S(=O)(=O)c2ccc3cc[nH]c3c2)s1)C(F)(F)F)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H44F3N3O6S2/c1-39(2,3)20-22-46(54(50,51)29-16-15-26-19-21-44-31(26)23-29)32(25-47)35-18-17-34(53-35)30(40(41,42)43)24-33(48)37(45-38(49)52-4)36(27-11-7-5-8-12-27)28-13-9-6-10-14-28/h5-19,21,23,30,32,36-37,44,47H,20,22,24-25H2,1-4H3,(H,45,49)/t30-,32-,37-/m1/s1 |
| InChIKey | ZBPHKQFKRGVRFS-BCNYVHJESA-N |
| XLogP | 8.55 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.94 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |