C34H42F3N3O6S — CID 74434678
methyl N-[9-[(4-aminophenyl)sulfonyl-propan-2-ylamino]-10-hydroxy-3-oxo-1,1-diphenyl-5-(trifluoromethyl)decan-2-yl]carbamate (PubChem CID 74434678) has the molecular formula C34H42F3N3O6S and a molecular weight of 677.79 g/mol. Its IUPAC name is methyl N-[9-[(4-aminophenyl)sulfonyl-propan-2-ylamino]-10-hydroxy-3-oxo-1,1-diphenyl-5-(trifluoromethyl)decan-2-yl]carbamate.
| Compound Name | methyl N-[9-[(4-aminophenyl)sulfonyl-propan-2-ylamino]-10-hydroxy-3-oxo-1,1-diphenyl-5-(trifluoromethyl)decan-2-yl]carbamate |
|---|---|
| PubChem CID | 74434678 |
| Molecular Formula | C34H42F3N3O6S |
| Molecular Weight | 677.79 g/mol |
| Exact Mass | 677.27 |
| IUPAC Name | methyl N-[9-[(4-aminophenyl)sulfonyl-propan-2-ylamino]-10-hydroxy-3-oxo-1,1-diphenyl-5-(trifluoromethyl)decan-2-yl]carbamate |
| SMILES | COC(=O)NC(C(=O)CC(CCCC(CO)N(C(C)C)S(=O)(=O)c1ccc(N)cc1)C(F)(F)F)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H42F3N3O6S/c1-23(2)40(47(44,45)29-19-17-27(38)18-20-29)28(22-41)16-10-15-26(34(35,36)37)21-30(42)32(39-33(43)46-3)31(24-11-6-4-7-12-24)25-13-8-5-9-14-25/h4-9,11-14,17-20,23,26,28,31-32,41H,10,15-16,21-22,38H2,1-3H3,(H,39,43) |
| InChIKey | IGXVBHWDXRPJRP-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 139.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.79 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|