C31H37F3N4O6S — CID 71590722
methyl N-[(2S)-1-[[(2R,6S)-6-[(4-aminophenyl)sulfonyl-methylamino]-1,1,1-trifluoro-7-hydroxyheptan-2-yl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate (PubChem CID 71590722) has the molecular formula C31H37F3N4O6S and a molecular weight of 650.72 g/mol. Its IUPAC name is methyl N-[(2S)-1-[[(2R,6S)-6-[(4-aminophenyl)sulfonyl-methylamino]-1,1,1-trifluoro-7-hydroxyheptan-2-yl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[[(2R,6S)-6-[(4-aminophenyl)sulfonyl-methylamino]-1,1,1-trifluoro-7-hydroxyheptan-2-yl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 71590722 |
| Molecular Formula | C31H37F3N4O6S |
| Molecular Weight | 650.72 g/mol |
| Exact Mass | 650.24 |
| IUPAC Name | methyl N-[(2S)-1-[[(2R,6S)-6-[(4-aminophenyl)sulfonyl-methylamino]-1,1,1-trifluoro-7-hydroxyheptan-2-yl]amino]-1-oxo-3,3-diphenylpropan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N[C@H](CCC[C@@H](CO)N(C)S(=O)(=O)c1ccc(N)cc1)C(F)(F)F)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H37F3N4O6S/c1-38(45(42,43)25-18-16-23(35)17-19-25)24(20-39)14-9-15-26(31(32,33)34)36-29(40)28(37-30(41)44-2)27(21-10-5-3-6-11-21)22-12-7-4-8-13-22/h3-8,10-13,16-19,24,26-28,39H,9,14-15,20,35H2,1-2H3,(H,36,40)(H,37,41)/t24-,26+,28-/m0/s1 |
| InChIKey | SBTROJKTVRNEBW-YIOBJHAYSA-N |
| XLogP | 4.02 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.72 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|