C11H16BiN3O9 — CID 159511743
bismuth;2-hydroxypropane-1,2,3-tricarboxylate;1-N'-methyl-2-nitrobut-1-ene-1,1-diamine (PubChem CID 159511743) has the molecular formula C11H16BiN3O9 and a molecular weight of 543.24 g/mol. Its IUPAC name is bismuth;2-hydroxypropane-1,2,3-tricarboxylate;1-N'-methyl-2-nitrobut-1-ene-1,1-diamine.
| Compound Name | bismuth;2-hydroxypropane-1,2,3-tricarboxylate;1-N'-methyl-2-nitrobut-1-ene-1,1-diamine |
|---|---|
| PubChem CID | 159511743 |
| Molecular Formula | C11H16BiN3O9 |
| Molecular Weight | 543.24 g/mol |
| Exact Mass | 543.07 |
| IUPAC Name | bismuth;2-hydroxypropane-1,2,3-tricarboxylate;1-N'-methyl-2-nitrobut-1-ene-1,1-diamine |
| SMILES | CCC(=C(N)NC)[N+](=O)[O-].O=C([O-])CC(O)(CC(=O)[O-])C(=O)[O-].[Bi+3] |
| InChI | InChI=1S/C6H8O7.C5H11N3O2.Bi/c7-3(8)1-6(13,5(11)12)2-4(9)10;1-3-4(8(9)10)5(6)7-2;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);7H,3,6H2,1-2H3;/q;;+3/p-3 |
| InChIKey | MAROFABTHUXYCY-UHFFFAOYSA-K |
| XLogP | -5.61 |
| TPSA | 221.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.24 |
| LogP ≤ 5 | -5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|