C18H18Cl3CuN3S2 — CID 159515450
6-chloro-3,5-dimethyl-1,2-benzothiazole;dichlorocopper;3,5-dimethyl-1,2-benzothiazol-6-amine (PubChem CID 159515450) has the molecular formula C18H18Cl3CuN3S2 and a molecular weight of 510.40 g/mol. Its IUPAC name is 6-chloro-3,5-dimethyl-1,2-benzothiazole;dichlorocopper;3,5-dimethyl-1,2-benzothiazol-6-amine.
| Compound Name | 6-chloro-3,5-dimethyl-1,2-benzothiazole;dichlorocopper;3,5-dimethyl-1,2-benzothiazol-6-amine |
|---|---|
| PubChem CID | 159515450 |
| Molecular Formula | C18H18Cl3CuN3S2 |
| Molecular Weight | 510.40 g/mol |
| Exact Mass | 507.93 |
| IUPAC Name | 6-chloro-3,5-dimethyl-1,2-benzothiazole;dichlorocopper;3,5-dimethyl-1,2-benzothiazol-6-amine |
| SMILES | Cc1cc2c(C)nsc2cc1Cl.Cc1cc2c(C)nsc2cc1N.Cl[Cu]Cl |
| InChI | InChI=1S/C9H8ClNS.C9H10N2S.2ClH.Cu/c2*1-5-3-7-6(2)11-12-9(7)4-8(5)10;;;/h3-4H,1-2H3;3-4H,10H2,1-2H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | MBDDHUSUXXJVQH-UHFFFAOYSA-L |
| XLogP | 7.44 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.40 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|