C26H29FN2O5S — CID 159515908
N-[2-fluoro-4-[5-[6-methyl-2-(2-phenoxyethoxy)-3-pyridinyl]-3-oxopentan-2-yl]phenyl]methanesulfonamide (PubChem CID 159515908) has the molecular formula C26H29FN2O5S and a molecular weight of 500.59 g/mol. Its IUPAC name is N-[2-fluoro-4-[5-[6-methyl-2-(2-phenoxyethoxy)-3-pyridinyl]-3-oxopentan-2-yl]phenyl]methanesulfonamide.
| Compound Name | N-[2-fluoro-4-[5-[6-methyl-2-(2-phenoxyethoxy)-3-pyridinyl]-3-oxopentan-2-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 159515908 |
| Molecular Formula | C26H29FN2O5S |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | N-[2-fluoro-4-[5-[6-methyl-2-(2-phenoxyethoxy)-3-pyridinyl]-3-oxopentan-2-yl]phenyl]methanesulfonamide |
| SMILES | Cc1ccc(CCC(=O)C(C)c2ccc(NS(C)(=O)=O)c(F)c2)c(OCCOc2ccccc2)n1 |
| InChI | InChI=1S/C26H29FN2O5S/c1-18-9-10-20(26(28-18)34-16-15-33-22-7-5-4-6-8-22)12-14-25(30)19(2)21-11-13-24(23(27)17-21)29-35(3,31)32/h4-11,13,17,19,29H,12,14-16H2,1-3H3 |
| InChIKey | MBEPWZZHYQBULT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|