C23H29FN2O4S — CID 159846915
N-[2-fluoro-4-[5-[6-methyl-2-(3-methylbut-2-enoxy)-3-pyridinyl]-3-oxopentan-2-yl]phenyl]methanesulfonamide (PubChem CID 159846915) has the molecular formula C23H29FN2O4S and a molecular weight of 448.56 g/mol. Its IUPAC name is N-[2-fluoro-4-[5-[6-methyl-2-(3-methylbut-2-enoxy)-3-pyridinyl]-3-oxopentan-2-yl]phenyl]methanesulfonamide.
| Compound Name | N-[2-fluoro-4-[5-[6-methyl-2-(3-methylbut-2-enoxy)-3-pyridinyl]-3-oxopentan-2-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 159846915 |
| Molecular Formula | C23H29FN2O4S |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | N-[2-fluoro-4-[5-[6-methyl-2-(3-methylbut-2-enoxy)-3-pyridinyl]-3-oxopentan-2-yl]phenyl]methanesulfonamide |
| SMILES | CC(C)=CCOc1nc(C)ccc1CCC(=O)C(C)c1ccc(NS(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C23H29FN2O4S/c1-15(2)12-13-30-23-18(7-6-16(3)25-23)9-11-22(27)17(4)19-8-10-21(20(24)14-19)26-31(5,28)29/h6-8,10,12,14,17,26H,9,11,13H2,1-5H3 |
| InChIKey | NPKRRRZHIQRHIL-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|