C12H12Cl2F3N3Si — CID 159516371
[1-[3,4-dichloro-5-(trifluoromethyl)phenyl]triazol-4-yl]-trimethylsilane (PubChem CID 159516371) has the molecular formula C12H12Cl2F3N3Si and a molecular weight of 354.24 g/mol. Its IUPAC name is [1-[3,4-dichloro-5-(trifluoromethyl)phenyl]triazol-4-yl]-trimethylsilane.
| Compound Name | [1-[3,4-dichloro-5-(trifluoromethyl)phenyl]triazol-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 159516371 |
| Molecular Formula | C12H12Cl2F3N3Si |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | [1-[3,4-dichloro-5-(trifluoromethyl)phenyl]triazol-4-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1cn(-c2cc(Cl)c(Cl)c(C(F)(F)F)c2)nn1 |
| InChI | InChI=1S/C12H12Cl2F3N3Si/c1-21(2,3)10-6-20(19-18-10)7-4-8(12(15,16)17)11(14)9(13)5-7/h4-6H,1-3H3 |
| InChIKey | HOXZCTCFZPYYRE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|