About 3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen
3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen (PubChem CID 159516750) has the molecular formula C12H19NO2S
and a molecular weight of 241.36 g/mol. Its IUPAC name is 3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen.
Molecular Properties
| Compound Name | 3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen |
| PubChem CID | 159516750 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen |
| SMILES | CSN(C)c1cccc(C(C)(C)C)c1.O=O |
| InChI | InChI=1S/C12H19NS.O2/c1-12(2,3)10-7-6-8-11(9-10)13(4)14-5;1-2/h6-9H,1-5H3; |
| InChIKey | MBHHOZLOFGKZRO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen?
The IUPAC name of 3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen (CID 159516750) is 3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen.
What is the SMILES notation for 3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen?
The canonical SMILES for 3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen is CSN(C)c1cccc(C(C)(C)C)c1.O=O.
What is the InChIKey of 3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen?
The InChIKey is MBHHOZLOFGKZRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NS.O2/c1-12(2,3)10-7-6-8-11(9-10)13(4)14-5;1-2/h6-9H,1-5H3;.
What are the key properties of 3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen?
3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen has a molecular weight of 241.36 g/mol, XLogP of 3.77, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen is sourced from PubChem (CID 159516750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).