3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen

C12H19NO2S — CID 159516750

IUPAC3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen
SMILESCSN(C)c1cccc(C(C)(C)C)c1.O=O
InChIInChI=1S/C12H19NS.O2/c1-12(2,3)10-7-6-8-11(9-10)13(4)14-5;1-2/h6-9H,1-5H3;
InChIKeyMBHHOZLOFGKZRO-UHFFFAOYSA-N
MW241.36 g/mol
LogP3.77
Rot. Bonds2

About 3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen

3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen (PubChem CID 159516750) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is 3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen.

Molecular Properties

Compound Name3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen
PubChem CID159516750
Molecular FormulaC12H19NO2S
Molecular Weight241.36 g/mol
Exact Mass241.11
IUPAC Name3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen
SMILESCSN(C)c1cccc(C(C)(C)C)c1.O=O
InChIInChI=1S/C12H19NS.O2/c1-12(2,3)10-7-6-8-11(9-10)13(4)14-5;1-2/h6-9H,1-5H3;
InChIKeyMBHHOZLOFGKZRO-UHFFFAOYSA-N
XLogP3.77
TPSA37.38 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.36
LogP ≤ 53.77
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen?
The IUPAC name of 3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen (CID 159516750) is 3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen.
What is the SMILES notation for 3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen?
The canonical SMILES for 3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen is CSN(C)c1cccc(C(C)(C)C)c1.O=O.
What is the InChIKey of 3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen?
The InChIKey is MBHHOZLOFGKZRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NS.O2/c1-12(2,3)10-7-6-8-11(9-10)13(4)14-5;1-2/h6-9H,1-5H3;.
What are the key properties of 3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen?
3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen has a molecular weight of 241.36 g/mol, XLogP of 3.77, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-N-methyl-N-methylsulfanylaniline;molecular oxygen is sourced from PubChem (CID 159516750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).