C17H24N2O3S2 — CID 159518613
N-[[4-(2,2-dimethylpropylsulfonyl)phenyl]carbamothioyl]cyclobutanecarboxamide (PubChem CID 159518613) has the molecular formula C17H24N2O3S2 and a molecular weight of 368.52 g/mol. Its IUPAC name is N-[[4-(2,2-dimethylpropylsulfonyl)phenyl]carbamothioyl]cyclobutanecarboxamide.
| Compound Name | N-[[4-(2,2-dimethylpropylsulfonyl)phenyl]carbamothioyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 159518613 |
| Molecular Formula | C17H24N2O3S2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | N-[[4-(2,2-dimethylpropylsulfonyl)phenyl]carbamothioyl]cyclobutanecarboxamide |
| SMILES | CC(C)(C)CS(=O)(=O)c1ccc(NC(=S)NC(=O)C2CCC2)cc1 |
| InChI | InChI=1S/C17H24N2O3S2/c1-17(2,3)11-24(21,22)14-9-7-13(8-10-14)18-16(23)19-15(20)12-5-4-6-12/h7-10,12H,4-6,11H2,1-3H3,(H2,18,19,20,23) |
| InChIKey | MBNDQWBXZMMXCG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|