C28H36O6S — CID 159519000
ethyl 2-benzyl-2-(methylsulfanylmethyl)-3-oxobutanoate;ethyl 2-benzyl-3-oxobutanoate (PubChem CID 159519000) has the molecular formula C28H36O6S and a molecular weight of 500.66 g/mol. Its IUPAC name is ethyl 2-benzyl-2-(methylsulfanylmethyl)-3-oxobutanoate;ethyl 2-benzyl-3-oxobutanoate.
| Compound Name | ethyl 2-benzyl-2-(methylsulfanylmethyl)-3-oxobutanoate;ethyl 2-benzyl-3-oxobutanoate |
|---|---|
| PubChem CID | 159519000 |
| Molecular Formula | C28H36O6S |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | ethyl 2-benzyl-2-(methylsulfanylmethyl)-3-oxobutanoate;ethyl 2-benzyl-3-oxobutanoate |
| SMILES | CCOC(=O)C(CSC)(Cc1ccccc1)C(C)=O.CCOC(=O)C(Cc1ccccc1)C(C)=O |
| InChI | InChI=1S/C15H20O3S.C13H16O3/c1-4-18-14(17)15(11-19-3,12(2)16)10-13-8-6-5-7-9-13;1-3-16-13(15)12(10(2)14)9-11-7-5-4-6-8-11/h5-9H,4,10-11H2,1-3H3;4-8,12H,3,9H2,1-2H3 |
| InChIKey | MBOKGNHEEPEBRI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|