C41H52O9 — CID 157138107
diethyl 2-benzylpropanedioate;diethyl 2-benzyl-2-prop-2-enylpropanedioate;1-phenylbut-3-en-1-ol (PubChem CID 157138107) has the molecular formula C41H52O9 and a molecular weight of 688.86 g/mol. Its IUPAC name is diethyl 2-benzylpropanedioate;diethyl 2-benzyl-2-prop-2-enylpropanedioate;1-phenylbut-3-en-1-ol.
| Compound Name | diethyl 2-benzylpropanedioate;diethyl 2-benzyl-2-prop-2-enylpropanedioate;1-phenylbut-3-en-1-ol |
|---|---|
| PubChem CID | 157138107 |
| Molecular Formula | C41H52O9 |
| Molecular Weight | 688.86 g/mol |
| Exact Mass | 688.36 |
| IUPAC Name | diethyl 2-benzylpropanedioate;diethyl 2-benzyl-2-prop-2-enylpropanedioate;1-phenylbut-3-en-1-ol |
| SMILES | C=CCC(Cc1ccccc1)(C(=O)OCC)C(=O)OCC.C=CCC(O)c1ccccc1.CCOC(=O)C(Cc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C17H22O4.C14H18O4.C10H12O/c1-4-12-17(15(18)20-5-2,16(19)21-6-3)13-14-10-8-7-9-11-14;1-3-17-13(15)12(14(16)18-4-2)10-11-8-6-5-7-9-11;1-2-6-10(11)9-7-4-3-5-8-9/h4,7-11H,1,5-6,12-13H2,2-3H3;5-9,12H,3-4,10H2,1-2H3;2-5,7-8,10-11H,1,6H2 |
| InChIKey | AJWDJUAKOGZFDZ-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.86 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|