About butanedioic acid;cyclohexylmethyl(dimethoxy)silane;dimethoxy(methyl)silane
butanedioic acid;cyclohexylmethyl(dimethoxy)silane;dimethoxy(methyl)silane (PubChem CID 159522456) has the molecular formula C16H36O8Si2
and a molecular weight of 412.63 g/mol. Its IUPAC name is butanedioic acid;cyclohexylmethyl(dimethoxy)silane;dimethoxy(methyl)silane.
Molecular Properties
| Compound Name | butanedioic acid;cyclohexylmethyl(dimethoxy)silane;dimethoxy(methyl)silane |
| PubChem CID | 159522456 |
| Molecular Formula | C16H36O8Si2 |
| Molecular Weight | 412.63 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | butanedioic acid;cyclohexylmethyl(dimethoxy)silane;dimethoxy(methyl)silane |
| SMILES | CO[SiH](C)OC.CO[SiH](CC1CCCCC1)OC.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C9H20O2Si.C4H6O4.C3H10O2Si/c1-10-12(11-2)8-9-6-4-3-5-7-9;5-3(6)1-2-4(7)8;1-4-6(3)5-2/h9,12H,3-8H2,1-2H3;1-2H2,(H,5,6)(H,7,8);6H,1-3H3 |
| InChIKey | MBYZXCRAGUYHHI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.63 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butanedioic acid;cyclohexylmethyl(dimethoxy)silane;dimethoxy(methyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanedioic acid;cyclohexylmethyl(dimethoxy)silane;dimethoxy(methyl)silane?
The IUPAC name of butanedioic acid;cyclohexylmethyl(dimethoxy)silane;dimethoxy(methyl)silane (CID 159522456) is butanedioic acid;cyclohexylmethyl(dimethoxy)silane;dimethoxy(methyl)silane.
What is the SMILES notation for butanedioic acid;cyclohexylmethyl(dimethoxy)silane;dimethoxy(methyl)silane?
The canonical SMILES for butanedioic acid;cyclohexylmethyl(dimethoxy)silane;dimethoxy(methyl)silane is CO[SiH](C)OC.CO[SiH](CC1CCCCC1)OC.O=C(O)CCC(=O)O.
What is the InChIKey of butanedioic acid;cyclohexylmethyl(dimethoxy)silane;dimethoxy(methyl)silane?
The InChIKey is MBYZXCRAGUYHHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O2Si.C4H6O4.C3H10O2Si/c1-10-12(11-2)8-9-6-4-3-5-7-9;5-3(6)1-2-4(7)8;1-4-6(3)5-2/h9,12H,3-8H2,1-2H3;1-2H2,(H,5,6)(H,7,8);6H,1-3H3.
What are the key properties of butanedioic acid;cyclohexylmethyl(dimethoxy)silane;dimethoxy(methyl)silane?
butanedioic acid;cyclohexylmethyl(dimethoxy)silane;dimethoxy(methyl)silane has a molecular weight of 412.63 g/mol, XLogP of 2.15, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for butanedioic acid;cyclohexylmethyl(dimethoxy)silane;dimethoxy(methyl)silane is sourced from PubChem (CID 159522456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).