C19H18F2O4S — CID 15953453
[(2S,4S)-3,3-difluoro-5-hydroxy-4-phenylmethoxythiolan-2-yl]methyl benzoate (PubChem CID 15953453) has the molecular formula C19H18F2O4S and a molecular weight of 380.41 g/mol. Its IUPAC name is [(2S,4S)-3,3-difluoro-5-hydroxy-4-phenylmethoxythiolan-2-yl]methyl benzoate.
| Compound Name | [(2S,4S)-3,3-difluoro-5-hydroxy-4-phenylmethoxythiolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 15953453 |
| Molecular Formula | C19H18F2O4S |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | [(2S,4S)-3,3-difluoro-5-hydroxy-4-phenylmethoxythiolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@@H]1SC(O)[C@@H](OCc2ccccc2)C1(F)F)c1ccccc1 |
| InChI | InChI=1S/C19H18F2O4S/c20-19(21)15(12-25-17(22)14-9-5-2-6-10-14)26-18(23)16(19)24-11-13-7-3-1-4-8-13/h1-10,15-16,18,23H,11-12H2/t15-,16+,18?/m0/s1 |
| InChIKey | YIPRFLRRFZRKNF-SWQDIRLTSA-N |
| XLogP | 3.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |