About 4-methoxy-6-(methylidene-oxo-thiophen-2-yl-λ6-sulfanyl)hexan-2-one;hydrate
4-methoxy-6-(methylidene-oxo-thiophen-2-yl-λ6-sulfanyl)hexan-2-one;hydrate (PubChem CID 159535731) has the molecular formula C12H20O4S2
and a molecular weight of 292.42 g/mol. Its IUPAC name is 4-methoxy-6-(methylidene-oxo-thiophen-2-yl-λ6-sulfanyl)hexan-2-one;hydrate.
Molecular Properties
| Compound Name | 4-methoxy-6-(methylidene-oxo-thiophen-2-yl-λ6-sulfanyl)hexan-2-one;hydrate |
| PubChem CID | 159535731 |
| Molecular Formula | C12H20O4S2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 4-methoxy-6-(methylidene-oxo-thiophen-2-yl-λ6-sulfanyl)hexan-2-one;hydrate |
| SMILES | C=S(=O)(CCC(CC(C)=O)OC)c1cccs1.O |
| InChI | InChI=1S/C12H18O3S2.H2O/c1-10(13)9-11(15-2)6-8-17(3,14)12-5-4-7-16-12;/h4-5,7,11H,3,6,8-9H2,1-2H3;1H2 |
| InChIKey | XRKBYWGMWMIPDM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 74.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-6-(methylidene-oxo-thiophen-2-yl-λ6-sulfanyl)hexan-2-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-6-(methylidene-oxo-thiophen-2-yl-λ6-sulfanyl)hexan-2-one;hydrate?
The IUPAC name of 4-methoxy-6-(methylidene-oxo-thiophen-2-yl-λ6-sulfanyl)hexan-2-one;hydrate (CID 159535731) is 4-methoxy-6-(methylidene-oxo-thiophen-2-yl-λ6-sulfanyl)hexan-2-one;hydrate.
What is the SMILES notation for 4-methoxy-6-(methylidene-oxo-thiophen-2-yl-λ6-sulfanyl)hexan-2-one;hydrate?
The canonical SMILES for 4-methoxy-6-(methylidene-oxo-thiophen-2-yl-λ6-sulfanyl)hexan-2-one;hydrate is C=S(=O)(CCC(CC(C)=O)OC)c1cccs1.O.
What is the InChIKey of 4-methoxy-6-(methylidene-oxo-thiophen-2-yl-λ6-sulfanyl)hexan-2-one;hydrate?
The InChIKey is XRKBYWGMWMIPDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3S2.H2O/c1-10(13)9-11(15-2)6-8-17(3,14)12-5-4-7-16-12;/h4-5,7,11H,3,6,8-9H2,1-2H3;1H2.
What are the key properties of 4-methoxy-6-(methylidene-oxo-thiophen-2-yl-λ6-sulfanyl)hexan-2-one;hydrate?
4-methoxy-6-(methylidene-oxo-thiophen-2-yl-λ6-sulfanyl)hexan-2-one;hydrate has a molecular weight of 292.42 g/mol, XLogP of 1.38, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-6-(methylidene-oxo-thiophen-2-yl-λ6-sulfanyl)hexan-2-one;hydrate is sourced from PubChem (CID 159535731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).