C20H36N2O7 — CID 159535792
methyl (2S)-2-[(4-ethoxy-4-oxobutyl)amino]butanoate;methyl 2-(2-oxopyrrolidin-1-yl)butanoate (PubChem CID 159535792) has the molecular formula C20H36N2O7 and a molecular weight of 416.52 g/mol. Its IUPAC name is methyl (2S)-2-[(4-ethoxy-4-oxobutyl)amino]butanoate;methyl 2-(2-oxopyrrolidin-1-yl)butanoate.
| Compound Name | methyl (2S)-2-[(4-ethoxy-4-oxobutyl)amino]butanoate;methyl 2-(2-oxopyrrolidin-1-yl)butanoate |
|---|---|
| PubChem CID | 159535792 |
| Molecular Formula | C20H36N2O7 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | methyl (2S)-2-[(4-ethoxy-4-oxobutyl)amino]butanoate;methyl 2-(2-oxopyrrolidin-1-yl)butanoate |
| SMILES | CCC(C(=O)OC)N1CCCC1=O.CCOC(=O)CCCN[C@@H](CC)C(=O)OC |
| InChI | InChI=1S/C11H21NO4.C9H15NO3/c1-4-9(11(14)15-3)12-8-6-7-10(13)16-5-2;1-3-7(9(12)13-2)10-6-4-5-8(10)11/h9,12H,4-8H2,1-3H3;7H,3-6H2,1-2H3/t9-;/m0./s1 |
| InChIKey | MDOJXBSIWZGMEZ-FVGYRXGTSA-N |
| XLogP | 1.43 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|