C19H17Br2N5O3 — CID 159541416
4-bromo-1-methylindazole-6-carboxamide;methyl 4-bromo-1-methylindazole-6-carboxylate (PubChem CID 159541416) has the molecular formula C19H17Br2N5O3 and a molecular weight of 523.19 g/mol. Its IUPAC name is 4-bromo-1-methylindazole-6-carboxamide;methyl 4-bromo-1-methylindazole-6-carboxylate.
| Compound Name | 4-bromo-1-methylindazole-6-carboxamide;methyl 4-bromo-1-methylindazole-6-carboxylate |
|---|---|
| PubChem CID | 159541416 |
| Molecular Formula | C19H17Br2N5O3 |
| Molecular Weight | 523.19 g/mol |
| Exact Mass | 520.97 |
| IUPAC Name | 4-bromo-1-methylindazole-6-carboxamide;methyl 4-bromo-1-methylindazole-6-carboxylate |
| SMILES | COC(=O)c1cc(Br)c2cnn(C)c2c1.Cn1ncc2c(Br)cc(C(N)=O)cc21 |
| InChI | InChI=1S/C10H9BrN2O2.C9H8BrN3O/c1-13-9-4-6(10(14)15-2)3-8(11)7(9)5-12-13;1-13-8-3-5(9(11)14)2-7(10)6(8)4-12-13/h3-5H,1-2H3;2-4H,1H3,(H2,11,14) |
| InChIKey | MEGKSIFATSKXJU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.19 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |