C33H43N9O6 — CID 159550490
1-[2-(2-ethoxyethoxy)ethyl]indazol-6-amine;2-[2-(2-ethoxyethoxy)ethyl]indazol-6-amine;6-nitro-1H-indazole (PubChem CID 159550490) has the molecular formula C33H43N9O6 and a molecular weight of 661.76 g/mol. Its IUPAC name is 1-[2-(2-ethoxyethoxy)ethyl]indazol-6-amine;2-[2-(2-ethoxyethoxy)ethyl]indazol-6-amine;6-nitro-1H-indazole.
| Compound Name | 1-[2-(2-ethoxyethoxy)ethyl]indazol-6-amine;2-[2-(2-ethoxyethoxy)ethyl]indazol-6-amine;6-nitro-1H-indazole |
|---|---|
| PubChem CID | 159550490 |
| Molecular Formula | C33H43N9O6 |
| Molecular Weight | 661.76 g/mol |
| Exact Mass | 661.33 |
| IUPAC Name | 1-[2-(2-ethoxyethoxy)ethyl]indazol-6-amine;2-[2-(2-ethoxyethoxy)ethyl]indazol-6-amine;6-nitro-1H-indazole |
| SMILES | CCOCCOCCn1cc2ccc(N)cc2n1.CCOCCOCCn1ncc2ccc(N)cc21.O=[N+]([O-])c1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/2C13H19N3O2.C7H5N3O2/c1-2-17-7-8-18-6-5-16-10-11-3-4-12(14)9-13(11)15-16;1-2-17-7-8-18-6-5-16-13-9-12(14)4-3-11(13)10-15-16;11-10(12)6-2-1-5-4-8-9-7(5)3-6/h2*3-4,9-10H,2,5-8,14H2,1H3;1-4H,(H,8,9) |
| InChIKey | MFICOHPYALDOBQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 196.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.76 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|