C29H55BNO14P — CID 159551703
CID 159551703 (PubChem CID 159551703) has the molecular formula C29H55BNO14P and a molecular weight of 683.54 g/mol.
| Compound Name | CID 159551703 |
|---|---|
| PubChem CID | 159551703 |
| Molecular Formula | C29H55BNO14P |
| Molecular Weight | 683.54 g/mol |
| Exact Mass | 683.35 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1O[C@H](COC(C)(C)C)C(O)[C@@H]1NC(=O)CCCOCCOCCOCCOP(=O)(O)OC[C@H]1O[C@@H](C)[C@@H](O)C1OC(C)(C)C |
| InChI | InChI=1S/C29H55BNO14P/c1-19-24(33)26(45-29(5,6)7)21(43-19)18-42-46(35,36)41-16-15-39-14-13-38-12-11-37-10-8-9-22(32)31-23-25(34)20(44-27(23)30)17-40-28(2,3)4/h19-21,23-27,33-34H,8-18H2,1-7H3,(H,31,32)(H,35,36)/t19-,20+,21+,23-,24+,25?,26?,27+/m0/s1 |
| InChIKey | VWLATPPLLDAAQN-NCZOKCQESA-N |
| XLogP | 0.84 |
| TPSA | 189.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.54 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|