C40H71NO15 — CID 59130121
[(2R,3R,4R,5R)-3,4,6-tris(2,2-dimethylpropanoyloxy)-5-[6-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]hexanoylamino]oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 59130121) has the molecular formula C40H71NO15 and a molecular weight of 806.00 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4,6-tris(2,2-dimethylpropanoyloxy)-5-[6-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]hexanoylamino]oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4R,5R)-3,4,6-tris(2,2-dimethylpropanoyloxy)-5-[6-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]hexanoylamino]oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59130121 |
| Molecular Formula | C40H71NO15 |
| Molecular Weight | 806.00 g/mol |
| Exact Mass | 805.48 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4,6-tris(2,2-dimethylpropanoyloxy)-5-[6-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]hexanoylamino]oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1OC(OC(=O)C(C)(C)C)[C@H](NC(=O)CCCCCOCCOCCOCCOCCO)[C@@H](OC(=O)C(C)(C)C)[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C40H71NO15/c1-37(2,3)33(44)52-26-27-30(54-34(45)38(4,5)6)31(55-35(46)39(7,8)9)29(32(53-27)56-36(47)40(10,11)12)41-28(43)16-14-13-15-18-48-20-22-50-24-25-51-23-21-49-19-17-42/h27,29-32,42H,13-26H2,1-12H3,(H,41,43)/t27-,29-,30+,31-,32?/m1/s1 |
| InChIKey | QOBJFIODHCYORE-AIBPWPEASA-N |
| XLogP | 3.91 |
| TPSA | 200.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.00 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|