C37H31Cl2N2O4+ — CID 159556244
amino 5-[[3-aminooxycarbonyl-4-[(2-chlorophenyl)methyl]phenyl]-(2,6-dimethylcyclohexa-2,4-dien-1-ylidene)methyl]-2-[(2-chlorophenyl)methyl]benzoate (PubChem CID 159556244) has the molecular formula C37H31Cl2N2O4+ and a molecular weight of 638.57 g/mol. Its IUPAC name is amino 5-[[3-aminooxycarbonyl-4-[(2-chlorophenyl)methyl]phenyl]-(2,6-dimethylcyclohexa-2,4-dien-1-ylidene)methyl]-2-[(2-chlorophenyl)methyl]benzoate.
| Compound Name | amino 5-[[3-aminooxycarbonyl-4-[(2-chlorophenyl)methyl]phenyl]-(2,6-dimethylcyclohexa-2,4-dien-1-ylidene)methyl]-2-[(2-chlorophenyl)methyl]benzoate |
|---|---|
| PubChem CID | 159556244 |
| Molecular Formula | C37H31Cl2N2O4+ |
| Molecular Weight | 638.57 g/mol |
| Exact Mass | 637.17 |
| IUPAC Name | amino 5-[[3-aminooxycarbonyl-4-[(2-chlorophenyl)methyl]phenyl]-(2,6-dimethylcyclohexa-2,4-dien-1-ylidene)methyl]-2-[(2-chlorophenyl)methyl]benzoate |
| SMILES | CC1=CC=C[C+](C)C1=C(c1ccc(Cc2ccccc2Cl)c(C(=O)ON)c1)c1ccc(Cc2ccccc2Cl)c(C(=O)ON)c1 |
| InChI | InChI=1S/C37H31Cl2N2O4/c1-22-8-7-9-23(2)34(22)35(28-16-14-24(30(20-28)36(42)44-40)18-26-10-3-5-12-32(26)38)29-17-15-25(31(21-29)37(43)45-41)19-27-11-4-6-13-33(27)39/h3-17,20-21H,18-19,40-41H2,1-2H3/q+1 |
| InChIKey | YYNYXEQBXICCKQ-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.57 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|