C17H23N3O8S2 — CID 159560470
methane;6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]-3H-quinazolin-4-one;sulfuric acid (PubChem CID 159560470) has the molecular formula C17H23N3O8S2 and a molecular weight of 461.52 g/mol. Its IUPAC name is methane;6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]-3H-quinazolin-4-one;sulfuric acid.
| Compound Name | methane;6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]-3H-quinazolin-4-one;sulfuric acid |
|---|---|
| PubChem CID | 159560470 |
| Molecular Formula | C17H23N3O8S2 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | methane;6-[5-[(2-methylsulfonylethylamino)methyl]furan-2-yl]-3H-quinazolin-4-one;sulfuric acid |
| SMILES | C.CS(=O)(=O)CCNCc1ccc(-c2ccc3nc[nH]c(=O)c3c2)o1.O=S(=O)(O)O |
| InChI | InChI=1S/C16H17N3O4S.CH4.H2O4S/c1-24(21,22)7-6-17-9-12-3-5-15(23-12)11-2-4-14-13(8-11)16(20)19-10-18-14;;1-5(2,3)4/h2-5,8,10,17H,6-7,9H2,1H3,(H,18,19,20);1H4;(H2,1,2,3,4) |
| InChIKey | DBDZWUQMNQJYKD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 179.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|