C20H38O4 — CID 159560663
2-ethoxyethanol;1-ethoxy-2-methoxyethane;1-ethyl-2-propylbenzene (PubChem CID 159560663) has the molecular formula C20H38O4 and a molecular weight of 342.52 g/mol. Its IUPAC name is 2-ethoxyethanol;1-ethoxy-2-methoxyethane;1-ethyl-2-propylbenzene.
| Compound Name | 2-ethoxyethanol;1-ethoxy-2-methoxyethane;1-ethyl-2-propylbenzene |
|---|---|
| PubChem CID | 159560663 |
| Molecular Formula | C20H38O4 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.28 |
| IUPAC Name | 2-ethoxyethanol;1-ethoxy-2-methoxyethane;1-ethyl-2-propylbenzene |
| SMILES | CCCc1ccccc1CC.CCOCCO.CCOCCOC |
| InChI | InChI=1S/C11H16.C5H12O2.C4H10O2/c1-3-7-11-9-6-5-8-10(11)4-2;1-3-7-5-4-6-2;1-2-6-4-3-5/h5-6,8-9H,3-4,7H2,1-2H3;3-5H2,1-2H3;5H,2-4H2,1H3 |
| InChIKey | MGONPXWZKVYPDR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|