C19H23N4O7P — CID 159563321
dimethoxyphosphoryl 1-benzylpyrazole-4-carboxylate;ethyl 1H-pyrazole-4-carboxylate (PubChem CID 159563321) has the molecular formula C19H23N4O7P and a molecular weight of 450.39 g/mol. Its IUPAC name is dimethoxyphosphoryl 1-benzylpyrazole-4-carboxylate;ethyl 1H-pyrazole-4-carboxylate.
| Compound Name | dimethoxyphosphoryl 1-benzylpyrazole-4-carboxylate;ethyl 1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 159563321 |
| Molecular Formula | C19H23N4O7P |
| Molecular Weight | 450.39 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | dimethoxyphosphoryl 1-benzylpyrazole-4-carboxylate;ethyl 1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn[nH]c1.COP(=O)(OC)OC(=O)c1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C13H15N2O5P.C6H8N2O2/c1-18-21(17,19-2)20-13(16)12-8-14-15(10-12)9-11-6-4-3-5-7-11;1-2-10-6(9)5-3-7-8-4-5/h3-8,10H,9H2,1-2H3;3-4H,2H2,1H3,(H,7,8) |
| InChIKey | MGWXHGCNYPKRRM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 134.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|