C8H15NO2S — CID 159565761
N-[(3S,4S)-4-methylhexa-1,5-dien-3-yl]methanesulfonamide (PubChem CID 159565761) has the molecular formula C8H15NO2S and a molecular weight of 189.28 g/mol. Its IUPAC name is N-[(3S,4S)-4-methylhexa-1,5-dien-3-yl]methanesulfonamide.
| Compound Name | N-[(3S,4S)-4-methylhexa-1,5-dien-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 159565761 |
| Molecular Formula | C8H15NO2S |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | N-[(3S,4S)-4-methylhexa-1,5-dien-3-yl]methanesulfonamide |
| SMILES | C=C[C@H](NS(C)(=O)=O)[C@@H](C)C=C |
| InChI | InChI=1S/C8H15NO2S/c1-5-7(3)8(6-2)9-12(4,10)11/h5-9H,1-2H2,3-4H3/t7-,8-/m0/s1 |
| InChIKey | MHEFDRUWXGUBRV-YUMQZZPRSA-N |
| XLogP | 0.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|