C47H48O4 — CID 159577279
dodeca-3,6,9-triyne;methyl docosa-4,7,10,13,16,19-hexaynoate;methyl undeca-4,7,10-triynoate (PubChem CID 159577279) has the molecular formula C47H48O4 and a molecular weight of 676.90 g/mol. Its IUPAC name is dodeca-3,6,9-triyne;methyl docosa-4,7,10,13,16,19-hexaynoate;methyl undeca-4,7,10-triynoate.
| Compound Name | dodeca-3,6,9-triyne;methyl docosa-4,7,10,13,16,19-hexaynoate;methyl undeca-4,7,10-triynoate |
|---|---|
| PubChem CID | 159577279 |
| Molecular Formula | C47H48O4 |
| Molecular Weight | 676.90 g/mol |
| Exact Mass | 676.36 |
| IUPAC Name | dodeca-3,6,9-triyne;methyl docosa-4,7,10,13,16,19-hexaynoate;methyl undeca-4,7,10-triynoate |
| SMILES | C#CCC#CCC#CCCC(=O)OC.CCC#CCC#CCC#CCC.CCC#CCC#CCC#CCC#CCC#CCC#CCCC(=O)OC |
| InChI | InChI=1S/C23H22O2.C12H12O2.C12H14/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25-2;1-3-4-5-6-7-8-9-10-11-12(13)14-2;1-3-5-7-9-11-12-10-8-6-4-2/h3,6,9,12,15,18,21-22H2,1-2H3;1H,4,7,10-11H2,2H3;3-4,9-10H2,1-2H3 |
| InChIKey | MIOKIJOWWOMUST-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.90 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|