C40H28O8 — CID 159584086
diphenyl benzene-1,2-dicarboxylate;3,4-diphenylphthalic acid (PubChem CID 159584086) has the molecular formula C40H28O8 and a molecular weight of 636.66 g/mol. Its IUPAC name is diphenyl benzene-1,2-dicarboxylate;3,4-diphenylphthalic acid.
| Compound Name | diphenyl benzene-1,2-dicarboxylate;3,4-diphenylphthalic acid |
|---|---|
| PubChem CID | 159584086 |
| Molecular Formula | C40H28O8 |
| Molecular Weight | 636.66 g/mol |
| Exact Mass | 636.18 |
| IUPAC Name | diphenyl benzene-1,2-dicarboxylate;3,4-diphenylphthalic acid |
| SMILES | O=C(O)c1ccc(-c2ccccc2)c(-c2ccccc2)c1C(=O)O.O=C(Oc1ccccc1)c1ccccc1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/2C20H14O4/c21-19(23-15-9-3-1-4-10-15)17-13-7-8-14-18(17)20(22)24-16-11-5-2-6-12-16;21-19(22)16-12-11-15(13-7-3-1-4-8-13)17(18(16)20(23)24)14-9-5-2-6-10-14/h1-14H;1-12H,(H,21,22)(H,23,24) |
| InChIKey | MJJTWEXOVVZVCZ-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.66 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|