About imino-bis(trifluoromethyl)-λ4-sulfane;1-(1-methylimidazol-2-yl)ethanol
imino-bis(trifluoromethyl)-λ4-sulfane;1-(1-methylimidazol-2-yl)ethanol (PubChem CID 159584729) has the molecular formula C8H11F6N3OS
and a molecular weight of 311.25 g/mol. Its IUPAC name is imino-bis(trifluoromethyl)-λ4-sulfane;1-(1-methylimidazol-2-yl)ethanol.
Molecular Properties
| Compound Name | imino-bis(trifluoromethyl)-λ4-sulfane;1-(1-methylimidazol-2-yl)ethanol |
| PubChem CID | 159584729 |
| Molecular Formula | C8H11F6N3OS |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | imino-bis(trifluoromethyl)-λ4-sulfane;1-(1-methylimidazol-2-yl)ethanol |
| SMILES | CC(O)c1nccn1C.[H]N=S(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H10N2O.C2HF6NS/c1-5(9)6-7-3-4-8(6)2;3-1(4,5)10(9)2(6,7)8/h3-5,9H,1-2H3;9H |
| InChIKey | MJLVEROQBMNYSL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze imino-bis(trifluoromethyl)-λ4-sulfane;1-(1-methylimidazol-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imino-bis(trifluoromethyl)-λ4-sulfane;1-(1-methylimidazol-2-yl)ethanol?
The IUPAC name of imino-bis(trifluoromethyl)-λ4-sulfane;1-(1-methylimidazol-2-yl)ethanol (CID 159584729) is imino-bis(trifluoromethyl)-λ4-sulfane;1-(1-methylimidazol-2-yl)ethanol.
What is the SMILES notation for imino-bis(trifluoromethyl)-λ4-sulfane;1-(1-methylimidazol-2-yl)ethanol?
The canonical SMILES for imino-bis(trifluoromethyl)-λ4-sulfane;1-(1-methylimidazol-2-yl)ethanol is CC(O)c1nccn1C.[H]N=S(C(F)(F)F)C(F)(F)F.
What is the InChIKey of imino-bis(trifluoromethyl)-λ4-sulfane;1-(1-methylimidazol-2-yl)ethanol?
The InChIKey is MJLVEROQBMNYSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O.C2HF6NS/c1-5(9)6-7-3-4-8(6)2;3-1(4,5)10(9)2(6,7)8/h3-5,9H,1-2H3;9H.
What are the key properties of imino-bis(trifluoromethyl)-λ4-sulfane;1-(1-methylimidazol-2-yl)ethanol?
imino-bis(trifluoromethyl)-λ4-sulfane;1-(1-methylimidazol-2-yl)ethanol has a molecular weight of 311.25 g/mol, XLogP of 2.88, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imino-bis(trifluoromethyl)-λ4-sulfane;1-(1-methylimidazol-2-yl)ethanol is sourced from PubChem (CID 159584729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).