C23H49Br2N7O — CID 159584965
triethyl-[[1-[N'-[N-methyl-N-[4-(3-methylmorpholin-4-ium-4-yl)butyl]carbamimidoyl]carbamimidoyl]pyrrolidin-2-yl]methyl]azanium dibromide (PubChem CID 159584965) has the molecular formula C23H49Br2N7O and a molecular weight of 599.50 g/mol. Its IUPAC name is triethyl-[[1-[N'-[N-methyl-N-[4-(3-methylmorpholin-4-ium-4-yl)butyl]carbamimidoyl]carbamimidoyl]pyrrolidin-2-yl]methyl]azanium dibromide.
| Compound Name | triethyl-[[1-[N'-[N-methyl-N-[4-(3-methylmorpholin-4-ium-4-yl)butyl]carbamimidoyl]carbamimidoyl]pyrrolidin-2-yl]methyl]azanium dibromide |
|---|---|
| PubChem CID | 159584965 |
| Molecular Formula | C23H49Br2N7O |
| Molecular Weight | 599.50 g/mol |
| Exact Mass | 597.24 |
| IUPAC Name | triethyl-[[1-[N'-[N-methyl-N-[4-(3-methylmorpholin-4-ium-4-yl)butyl]carbamimidoyl]carbamimidoyl]pyrrolidin-2-yl]methyl]azanium dibromide |
| SMILES | [Br-].[Br-].[H]/N=C(\N=C(N)N1CCCC1C[N+](CC)(CC)CC)N(C)CCCC[NH+]1CCOCC1C |
| InChI | InChI=1S/C23H48N7O.2BrH/c1-6-30(7-2,8-3)18-21-12-11-15-29(21)23(25)26-22(24)27(5)13-9-10-14-28-16-17-31-19-20(28)4;;/h20-21H,6-19H2,1-5H3,(H3,24,25,26);2*1H/q+1;;/p-1 |
| InChIKey | LYPRNRDAASTNAY-UHFFFAOYSA-M |
| XLogP | -5.40 |
| TPSA | 82.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.50 |
| LogP ≤ 5 | -5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|