C7H8Cl3I3NO2SV — CID 159585170
3,4-dimethyl-1-(trichloromethylsulfanyl)pyrrolidine-2,5-dione;triiodovanadium (PubChem CID 159585170) has the molecular formula C7H8Cl3I3NO2SV and a molecular weight of 708.23 g/mol. Its IUPAC name is 3,4-dimethyl-1-(trichloromethylsulfanyl)pyrrolidine-2,5-dione;triiodovanadium.
| Compound Name | 3,4-dimethyl-1-(trichloromethylsulfanyl)pyrrolidine-2,5-dione;triiodovanadium |
|---|---|
| PubChem CID | 159585170 |
| Molecular Formula | C7H8Cl3I3NO2SV |
| Molecular Weight | 708.23 g/mol |
| Exact Mass | 706.59 |
| IUPAC Name | 3,4-dimethyl-1-(trichloromethylsulfanyl)pyrrolidine-2,5-dione;triiodovanadium |
| SMILES | CC1C(=O)N(SC(Cl)(Cl)Cl)C(=O)C1C.I[V](I)I |
| InChI | InChI=1S/C7H8Cl3NO2S.3HI.V/c1-3-4(2)6(13)11(5(3)12)14-7(8,9)10;;;;/h3-4H,1-2H3;3*1H;/q;;;;+3/p-3 |
| InChIKey | MJNGUFXLYNFECH-UHFFFAOYSA-K |
| XLogP | 5.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.23 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|