C5H4Cl3NO2S2 — CID 163729962
5-methyl-3-(trichloromethylsulfanyl)-1,3-thiazolidine-2,4-dione (PubChem CID 163729962) has the molecular formula C5H4Cl3NO2S2 and a molecular weight of 280.59 g/mol. Its IUPAC name is 5-methyl-3-(trichloromethylsulfanyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-methyl-3-(trichloromethylsulfanyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 163729962 |
| Molecular Formula | C5H4Cl3NO2S2 |
| Molecular Weight | 280.59 g/mol |
| Exact Mass | 278.87 |
| IUPAC Name | 5-methyl-3-(trichloromethylsulfanyl)-1,3-thiazolidine-2,4-dione |
| SMILES | CC1SC(=O)N(SC(Cl)(Cl)Cl)C1=O |
| InChI | InChI=1S/C5H4Cl3NO2S2/c1-2-3(10)9(4(11)12-2)13-5(6,7)8/h2H,1H3 |
| InChIKey | KYTWRJJQPWAIQV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.59 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|