C37H34FN7O6 — CID 159588611
1-fluoro-2-methyl-4-nitrobenzene;3-methyl-4-(1-methylbenzimidazol-5-yl)oxyaniline;1-methyl-5-(2-methyl-4-nitrophenoxy)benzimidazole (PubChem CID 159588611) has the molecular formula C37H34FN7O6 and a molecular weight of 691.72 g/mol. Its IUPAC name is 1-fluoro-2-methyl-4-nitrobenzene;3-methyl-4-(1-methylbenzimidazol-5-yl)oxyaniline;1-methyl-5-(2-methyl-4-nitrophenoxy)benzimidazole.
| Compound Name | 1-fluoro-2-methyl-4-nitrobenzene;3-methyl-4-(1-methylbenzimidazol-5-yl)oxyaniline;1-methyl-5-(2-methyl-4-nitrophenoxy)benzimidazole |
|---|---|
| PubChem CID | 159588611 |
| Molecular Formula | C37H34FN7O6 |
| Molecular Weight | 691.72 g/mol |
| Exact Mass | 691.26 |
| IUPAC Name | 1-fluoro-2-methyl-4-nitrobenzene;3-methyl-4-(1-methylbenzimidazol-5-yl)oxyaniline;1-methyl-5-(2-methyl-4-nitrophenoxy)benzimidazole |
| SMILES | Cc1cc(N)ccc1Oc1ccc2c(c1)ncn2C.Cc1cc([N+](=O)[O-])ccc1F.Cc1cc([N+](=O)[O-])ccc1Oc1ccc2c(c1)ncn2C |
| InChI | InChI=1S/C15H13N3O3.C15H15N3O.C7H6FNO2/c1-10-7-11(18(19)20)3-6-15(10)21-12-4-5-14-13(8-12)16-9-17(14)2;1-10-7-11(16)3-6-15(10)19-12-4-5-14-13(8-12)17-9-18(14)2;1-5-4-6(9(10)11)2-3-7(5)8/h3-9H,1-2H3;3-9H,16H2,1-2H3;2-4H,1H3 |
| InChIKey | MJYISJRFXSABHW-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 166.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.72 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|