C14H12ClN2O3PS — CID 15958992
5-chloro-3-[methoxy(thiophen-2-yl)phosphoryl]-1H-indole-2-carboxamide (PubChem CID 15958992) has the molecular formula C14H12ClN2O3PS and a molecular weight of 354.76 g/mol. Its IUPAC name is 5-chloro-3-[methoxy(thiophen-2-yl)phosphoryl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-3-[methoxy(thiophen-2-yl)phosphoryl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 15958992 |
| Molecular Formula | C14H12ClN2O3PS |
| Molecular Weight | 354.76 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 5-chloro-3-[methoxy(thiophen-2-yl)phosphoryl]-1H-indole-2-carboxamide |
| SMILES | COP(=O)(c1cccs1)c1c(C(N)=O)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C14H12ClN2O3PS/c1-20-21(19,11-3-2-6-22-11)13-9-7-8(15)4-5-10(9)17-12(13)14(16)18/h2-7,17H,1H3,(H2,16,18) |
| InChIKey | CGBRVFGUPUAYMU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 85.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.76 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|