C16H11Cl5N4O2 — CID 159591813
2-(chloromethyl)-5-(3,4-dichlorophenyl)-1,3,4-oxadiazole;3,4-dichlorobenzohydrazide (PubChem CID 159591813) has the molecular formula C16H11Cl5N4O2 and a molecular weight of 468.56 g/mol. Its IUPAC name is 2-(chloromethyl)-5-(3,4-dichlorophenyl)-1,3,4-oxadiazole;3,4-dichlorobenzohydrazide.
| Compound Name | 2-(chloromethyl)-5-(3,4-dichlorophenyl)-1,3,4-oxadiazole;3,4-dichlorobenzohydrazide |
|---|---|
| PubChem CID | 159591813 |
| Molecular Formula | C16H11Cl5N4O2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 465.93 |
| IUPAC Name | 2-(chloromethyl)-5-(3,4-dichlorophenyl)-1,3,4-oxadiazole;3,4-dichlorobenzohydrazide |
| SMILES | ClCc1nnc(-c2ccc(Cl)c(Cl)c2)o1.NNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H5Cl3N2O.C7H6Cl2N2O/c10-4-8-13-14-9(15-8)5-1-2-6(11)7(12)3-5;8-5-2-1-4(3-6(5)9)7(12)11-10/h1-3H,4H2;1-3H,10H2,(H,11,12) |
| InChIKey | MKIMQOLPDXCJAC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|