C12H22N5O+ — CID 159595242
1-amino-3-[4-(1,1-dimethylpiperidin-1-ium-4-yl)triazol-1-yl]propan-2-one (PubChem CID 159595242) has the molecular formula C12H22N5O+ and a molecular weight of 252.34 g/mol. Its IUPAC name is 1-amino-3-[4-(1,1-dimethylpiperidin-1-ium-4-yl)triazol-1-yl]propan-2-one.
| Compound Name | 1-amino-3-[4-(1,1-dimethylpiperidin-1-ium-4-yl)triazol-1-yl]propan-2-one |
|---|---|
| PubChem CID | 159595242 |
| Molecular Formula | C12H22N5O+ |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 1-amino-3-[4-(1,1-dimethylpiperidin-1-ium-4-yl)triazol-1-yl]propan-2-one |
| SMILES | C[N+]1(C)CCC(c2cn(CC(=O)CN)nn2)CC1 |
| InChI | InChI=1S/C12H22N5O/c1-17(2)5-3-10(4-6-17)12-9-16(15-14-12)8-11(18)7-13/h9-10H,3-8,13H2,1-2H3/q+1 |
| InChIKey | OQXIEEYKZWKHDY-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|