C20H17F5N4O3S — CID 159601668
2-[3-ethylsulfonyl-5-(2-methylbut-3-yn-2-yloxy)-2-pyridinyl]-7-(1,1,2,2,2-pentafluoroethyl)imidazo[1,2-c]pyrimidine (PubChem CID 159601668) has the molecular formula C20H17F5N4O3S and a molecular weight of 488.44 g/mol. Its IUPAC name is 2-[3-ethylsulfonyl-5-(2-methylbut-3-yn-2-yloxy)-2-pyridinyl]-7-(1,1,2,2,2-pentafluoroethyl)imidazo[1,2-c]pyrimidine.
| Compound Name | 2-[3-ethylsulfonyl-5-(2-methylbut-3-yn-2-yloxy)-2-pyridinyl]-7-(1,1,2,2,2-pentafluoroethyl)imidazo[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 159601668 |
| Molecular Formula | C20H17F5N4O3S |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | 2-[3-ethylsulfonyl-5-(2-methylbut-3-yn-2-yloxy)-2-pyridinyl]-7-(1,1,2,2,2-pentafluoroethyl)imidazo[1,2-c]pyrimidine |
| SMILES | C#CC(C)(C)Oc1cnc(-c2cn3cnc(C(F)(F)C(F)(F)F)cc3n2)c(S(=O)(=O)CC)c1 |
| InChI | InChI=1S/C20H17F5N4O3S/c1-5-18(3,4)32-12-7-14(33(30,31)6-2)17(26-9-12)13-10-29-11-27-15(8-16(29)28-13)19(21,22)20(23,24)25/h1,7-11H,6H2,2-4H3 |
| InChIKey | MLODQSKJGDKFAP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 86.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|